C21H22N6O — CID 165411345
N-[6-(ethylamino)-4-[2-(4-methyl-1,2,4-triazol-3-yl)phenyl]-2-pyridinyl]-2-methylidenebut-3-enamide (PubChem CID 165411345) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is N-[6-(ethylamino)-4-[2-(4-methyl-1,2,4-triazol-3-yl)phenyl]-2-pyridinyl]-2-methylidenebut-3-enamide.
| Compound Name | N-[6-(ethylamino)-4-[2-(4-methyl-1,2,4-triazol-3-yl)phenyl]-2-pyridinyl]-2-methylidenebut-3-enamide |
|---|---|
| PubChem CID | 165411345 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-[6-(ethylamino)-4-[2-(4-methyl-1,2,4-triazol-3-yl)phenyl]-2-pyridinyl]-2-methylidenebut-3-enamide |
| SMILES | C=CC(=C)C(=O)Nc1cc(-c2ccccc2-c2nncn2C)cc(NCC)n1 |
| InChI | InChI=1S/C21H22N6O/c1-5-14(3)21(28)25-19-12-15(11-18(24-19)22-6-2)16-9-7-8-10-17(16)20-26-23-13-27(20)4/h5,7-13H,1,3,6H2,2,4H3,(H2,22,24,25,28) |
| InChIKey | GTCWBCDMQOHIAL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|