C24H24FN5O2S — CID 165412132
(4R)-1-[3-(2-fluoro-4-methyl-3-pyridinyl)phenyl]-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]pyrrolidin-2-one (PubChem CID 165412132) has the molecular formula C24H24FN5O2S and a molecular weight of 465.55 g/mol. Its IUPAC name is (4R)-1-[3-(2-fluoro-4-methyl-3-pyridinyl)phenyl]-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]pyrrolidin-2-one.
| Compound Name | (4R)-1-[3-(2-fluoro-4-methyl-3-pyridinyl)phenyl]-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 165412132 |
| Molecular Formula | C24H24FN5O2S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (4R)-1-[3-(2-fluoro-4-methyl-3-pyridinyl)phenyl]-4-[4-(1,3-thiazole-2-carbonyl)piperazin-1-yl]pyrrolidin-2-one |
| SMILES | Cc1ccnc(F)c1-c1cccc(N2C[C@H](N3CCN(C(=O)c4nccs4)CC3)CC2=O)c1 |
| InChI | InChI=1S/C24H24FN5O2S/c1-16-5-6-26-22(25)21(16)17-3-2-4-18(13-17)30-15-19(14-20(30)31)28-8-10-29(11-9-28)24(32)23-27-7-12-33-23/h2-7,12-13,19H,8-11,14-15H2,1H3/t19-/m1/s1 |
| InChIKey | BSDIMVPELJZNRU-LJQANCHMSA-N |
| XLogP | 3.22 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|