C18H21N5O3S — CID 165412708
5-(4-methoxyphenyl)-6-(morpholin-4-ylmethyl)imidazo[2,1-b][1,3]thiazole-3-carbohydrazide (PubChem CID 165412708) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-6-(morpholin-4-ylmethyl)imidazo[2,1-b][1,3]thiazole-3-carbohydrazide.
| Compound Name | 5-(4-methoxyphenyl)-6-(morpholin-4-ylmethyl)imidazo[2,1-b][1,3]thiazole-3-carbohydrazide |
|---|---|
| PubChem CID | 165412708 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-6-(morpholin-4-ylmethyl)imidazo[2,1-b][1,3]thiazole-3-carbohydrazide |
| SMILES | COc1ccc(-c2c(CN3CCOCC3)nc3scc(C(=O)NN)n23)cc1 |
| InChI | InChI=1S/C18H21N5O3S/c1-25-13-4-2-12(3-5-13)16-14(10-22-6-8-26-9-7-22)20-18-23(16)15(11-27-18)17(24)21-19/h2-5,11H,6-10,19H2,1H3,(H,21,24) |
| InChIKey | ADWBIWIWVFJDMV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|