C16H12N2O3 — CID 165412813
N-(4-acetylphenyl)-1,2-benzoxazole-3-carboxamide (PubChem CID 165412813) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is N-(4-acetylphenyl)-1,2-benzoxazole-3-carboxamide.
| Compound Name | N-(4-acetylphenyl)-1,2-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 165412813 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | N-(4-acetylphenyl)-1,2-benzoxazole-3-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2noc3ccccc23)cc1 |
| InChI | InChI=1S/C16H12N2O3/c1-10(19)11-6-8-12(9-7-11)17-16(20)15-13-4-2-3-5-14(13)21-18-15/h2-9H,1H3,(H,17,20) |
| InChIKey | PLIVETCICWRHCP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |