C22H16N4O3S — CID 165413190
9-methyl-5-[3-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione (PubChem CID 165413190) has the molecular formula C22H16N4O3S and a molecular weight of 416.46 g/mol. Its IUPAC name is 9-methyl-5-[3-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione.
| Compound Name | 9-methyl-5-[3-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 165413190 |
| Molecular Formula | C22H16N4O3S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 9-methyl-5-[3-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| SMILES | Cc1ccc2c3c(ccc2c1)N(c1cccc(-c2nc(=S)o[nH]2)c1)C(=O)CC(=O)N3 |
| InChI | InChI=1S/C22H16N4O3S/c1-12-5-7-16-13(9-12)6-8-17-20(16)23-18(27)11-19(28)26(17)15-4-2-3-14(10-15)21-24-22(30)29-25-21/h2-10H,11H2,1H3,(H,23,27)(H,24,25,30) |
| InChIKey | KQCRGMYQFQXBAY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|