C26H26N4 — CID 165413450
10-cyclohexyl-11,12-diphenyl-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene (PubChem CID 165413450) has the molecular formula C26H26N4 and a molecular weight of 394.52 g/mol. Its IUPAC name is 10-cyclohexyl-11,12-diphenyl-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene.
| Compound Name | 10-cyclohexyl-11,12-diphenyl-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene |
|---|---|
| PubChem CID | 165413450 |
| Molecular Formula | C26H26N4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 10-cyclohexyl-11,12-diphenyl-3,6,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene |
| SMILES | C1=Nc2c(c(-c3ccccc3)c(-c3ccccc3)n2C2CCCCC2)C2=NCCN12 |
| InChI | InChI=1S/C26H26N4/c1-4-10-19(11-5-1)22-23-25-27-16-17-29(25)18-28-26(23)30(21-14-8-3-9-15-21)24(22)20-12-6-2-7-13-20/h1-2,4-7,10-13,18,21H,3,8-9,14-17H2 |
| InChIKey | CFLXTXFJKLWPJA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 32.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |