C21H18F6N6O3S — CID 165413736
2-ethyl-6,8-difluoro-N-[[3-fluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 165413736) has the molecular formula C21H18F6N6O3S and a molecular weight of 548.47 g/mol. Its IUPAC name is 2-ethyl-6,8-difluoro-N-[[3-fluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-ethyl-6,8-difluoro-N-[[3-fluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 165413736 |
| Molecular Formula | C21H18F6N6O3S |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 2-ethyl-6,8-difluoro-N-[[3-fluoro-4-[4-(trifluoromethylsulfonyl)-5,6-dihydro-1,2,4-triazin-1-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2c(F)cc(F)cn2c1C(=O)NCc1ccc(N2CCN(S(=O)(=O)C(F)(F)F)C=N2)c(F)c1 |
| InChI | InChI=1S/C21H18F6N6O3S/c1-2-16-18(32-10-13(22)8-15(24)19(32)30-16)20(34)28-9-12-3-4-17(14(23)7-12)33-6-5-31(11-29-33)37(35,36)21(25,26)27/h3-4,7-8,10-11H,2,5-6,9H2,1H3,(H,28,34) |
| InChIKey | HKVLRMLGWIQBOQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |