C29H34N6O4 — CID 165413748
2-cyclopropyl-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one;N'-hydroxy-N-phenyloctanediamide (PubChem CID 165413748) has the molecular formula C29H34N6O4 and a molecular weight of 530.63 g/mol. Its IUPAC name is 2-cyclopropyl-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one;N'-hydroxy-N-phenyloctanediamide.
| Compound Name | 2-cyclopropyl-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one;N'-hydroxy-N-phenyloctanediamide |
|---|---|
| PubChem CID | 165413748 |
| Molecular Formula | C29H34N6O4 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 2-cyclopropyl-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one;N'-hydroxy-N-phenyloctanediamide |
| SMILES | Cc1ccnc2c1NC(=O)c1cccnc1N2C1CC1.O=C(CCCCCCC(=O)Nc1ccccc1)NO |
| InChI | InChI=1S/C15H14N4O.C14H20N2O3/c1-9-6-8-17-14-12(9)18-15(20)11-3-2-7-16-13(11)19(14)10-4-5-10;17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h2-3,6-8,10H,4-5H2,1H3,(H,18,20);3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18) |
| InChIKey | VNHVLTVSZIRRCF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|