C18H24ClN3O — CID 165414128
6-chloro-N-(3-cyclohexylpropyl)-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 165414128) has the molecular formula C18H24ClN3O and a molecular weight of 333.86 g/mol. Its IUPAC name is 6-chloro-N-(3-cyclohexylpropyl)-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(3-cyclohexylpropyl)-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 165414128 |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 6-chloro-N-(3-cyclohexylpropyl)-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc2ccc(Cl)cn2c1C(=O)NCCCC1CCCCC1 |
| InChI | InChI=1S/C18H24ClN3O/c1-13-17(22-12-15(19)9-10-16(22)21-13)18(23)20-11-5-8-14-6-3-2-4-7-14/h9-10,12,14H,2-8,11H2,1H3,(H,20,23) |
| InChIKey | GJTAHKUXQJZJKY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|