C29H33N4O6S- — CID 165414251
CID 165414251 (PubChem CID 165414251) has the molecular formula C29H33N4O6S- and a molecular weight of 565.67 g/mol.
| Compound Name | CID 165414251 |
|---|---|
| PubChem CID | 165414251 |
| Molecular Formula | C29H33N4O6S- |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | — |
| SMILES | C=[S-](=O)C(O)C1C[C@@]2(CN1C(=O)[C@H](CC(C)C)NC(=O)c1cc3c(OC)cccc3[nH]1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C29H33N4O6S/c1-16(2)12-22(31-25(34)21-13-17-19(30-21)10-7-11-24(17)39-3)26(35)33-15-29(14-23(33)27(36)40(4)38)18-8-5-6-9-20(18)32-28(29)37/h5-11,13,16,22-23,27,30,36H,4,12,14-15H2,1-3H3,(H,31,34)(H,32,37)/q-1/t22-,23?,27?,29-/m0/s1 |
| InChIKey | NANKSNNFQILANV-UVFGIFBTSA-N |
| XLogP | 2.53 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|