C28H33N5O3 — CID 165414562
2-[4-(7-phenylmethoxy-1H-indole-3-carbonyl)piperazin-1-yl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one (PubChem CID 165414562) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-[4-(7-phenylmethoxy-1H-indole-3-carbonyl)piperazin-1-yl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-(7-phenylmethoxy-1H-indole-3-carbonyl)piperazin-1-yl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 165414562 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 2-[4-(7-phenylmethoxy-1H-indole-3-carbonyl)piperazin-1-yl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(N2CCN(C(=O)c3c[nH]c4c(OCc5ccccc5)cccc34)CC2)NC2CCCCC12 |
| InChI | InChI=1S/C28H33N5O3/c34-26-21-9-4-5-11-23(21)30-28(31-26)33-15-13-32(14-16-33)27(35)22-17-29-25-20(22)10-6-12-24(25)36-18-19-7-2-1-3-8-19/h1-3,6-8,10,12,17,21,23,28-30H,4-5,9,11,13-16,18H2,(H,31,34) |
| InChIKey | ZDEFRLMGBUJCJD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |