C23H21ClN6O — CID 165414873
2-chloro-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-6-piperidin-1-ylpyridine-4-carboxamide (PubChem CID 165414873) has the molecular formula C23H21ClN6O and a molecular weight of 432.92 g/mol. Its IUPAC name is 2-chloro-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-6-piperidin-1-ylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-6-piperidin-1-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 165414873 |
| Molecular Formula | C23H21ClN6O |
| Molecular Weight | 432.92 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-chloro-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-6-piperidin-1-ylpyridine-4-carboxamide |
| SMILES | O=C(Nc1ccn2nc(-c3ccccc3)nc2c1)c1cc(Cl)nc(N2CCCCC2)c1 |
| InChI | InChI=1S/C23H21ClN6O/c24-19-13-17(14-20(26-19)29-10-5-2-6-11-29)23(31)25-18-9-12-30-21(15-18)27-22(28-30)16-7-3-1-4-8-16/h1,3-4,7-9,12-15H,2,5-6,10-11H2,(H,25,31) |
| InChIKey | RHUKFFYUGFDTTH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|