C22H19ClN6O — CID 165414893
2-chloro-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-6-pyrrolidin-1-ylpyridine-4-carboxamide (PubChem CID 165414893) has the molecular formula C22H19ClN6O and a molecular weight of 418.89 g/mol. Its IUPAC name is 2-chloro-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-6-pyrrolidin-1-ylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-6-pyrrolidin-1-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 165414893 |
| Molecular Formula | C22H19ClN6O |
| Molecular Weight | 418.89 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-chloro-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-6-pyrrolidin-1-ylpyridine-4-carboxamide |
| SMILES | O=C(Nc1ccn2nc(-c3ccccc3)nc2c1)c1cc(Cl)nc(N2CCCC2)c1 |
| InChI | InChI=1S/C22H19ClN6O/c23-18-12-16(13-19(25-18)28-9-4-5-10-28)22(30)24-17-8-11-29-20(14-17)26-21(27-29)15-6-2-1-3-7-15/h1-3,6-8,11-14H,4-5,9-10H2,(H,24,30) |
| InChIKey | MEQGSYFWZWKCNR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.89 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|