C23H28N6O3 — CID 165414895
4-N-ethyl-5-N-[(7R)-2-(3-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]-4-N,1-dimethylpyrazole-4,5-dicarboxamide (PubChem CID 165414895) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 4-N-ethyl-5-N-[(7R)-2-(3-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]-4-N,1-dimethylpyrazole-4,5-dicarboxamide.
| Compound Name | 4-N-ethyl-5-N-[(7R)-2-(3-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]-4-N,1-dimethylpyrazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 165414895 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 4-N-ethyl-5-N-[(7R)-2-(3-methoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]-4-N,1-dimethylpyrazole-4,5-dicarboxamide |
| SMILES | CCN(C)C(=O)c1cnn(C)c1C(=O)N[C@@H]1CCn2cc(-c3cccc(OC)c3)nc2C1 |
| InChI | InChI=1S/C23H28N6O3/c1-5-27(2)23(31)18-13-24-28(3)21(18)22(30)25-16-9-10-29-14-19(26-20(29)12-16)15-7-6-8-17(11-15)32-4/h6-8,11,13-14,16H,5,9-10,12H2,1-4H3,(H,25,30)/t16-/m1/s1 |
| InChIKey | ZHVIXBKRXYENIR-MRXNPFEDSA-N |
| XLogP | 2.13 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |