C20H17ClN6O — CID 165414906
2-chloro-6-(dimethylamino)-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyridine-4-carboxamide (PubChem CID 165414906) has the molecular formula C20H17ClN6O and a molecular weight of 392.85 g/mol. Its IUPAC name is 2-chloro-6-(dimethylamino)-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-(dimethylamino)-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 165414906 |
| Molecular Formula | C20H17ClN6O |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-chloro-6-(dimethylamino)-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyridine-4-carboxamide |
| SMILES | CN(C)c1cc(C(=O)Nc2ccn3nc(-c4ccccc4)nc3c2)cc(Cl)n1 |
| InChI | InChI=1S/C20H17ClN6O/c1-26(2)17-11-14(10-16(21)23-17)20(28)22-15-8-9-27-18(12-15)24-19(25-27)13-6-4-3-5-7-13/h3-12H,1-2H3,(H,22,28) |
| InChIKey | GSYOLHZZDUNONG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|