About 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine
4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine (PubChem CID 165414919) has the molecular formula C20H23N3O
and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine.
Molecular Properties
| Compound Name | 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine |
| PubChem CID | 165414919 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine |
| SMILES | COc1c(C)cnc(CCc2nc(-c3ccccc3)cn2C)c1C |
| InChI | InChI=1S/C20H23N3O/c1-14-12-21-17(15(2)20(14)24-4)10-11-19-22-18(13-23(19)3)16-8-6-5-7-9-16/h5-9,12-13H,10-11H2,1-4H3 |
| InChIKey | JCOFREJWGMBVCW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine?
The IUPAC name of 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine (CID 165414919) is 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine.
What is the SMILES notation for 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine?
The canonical SMILES for 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine is COc1c(C)cnc(CCc2nc(-c3ccccc3)cn2C)c1C.
What is the InChIKey of 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine?
The InChIKey is JCOFREJWGMBVCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O/c1-14-12-21-17(15(2)20(14)24-4)10-11-19-22-18(13-23(19)3)16-8-6-5-7-9-16/h5-9,12-13H,10-11H2,1-4H3.
What are the key properties of 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine?
4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine has a molecular weight of 321.42 g/mol, XLogP of 3.89, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3,5-dimethyl-2-[2-(1-methyl-4-phenylimidazol-2-yl)ethyl]pyridine is sourced from PubChem (CID 165414919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).