C22H26N6O2 — CID 165414938
4-N-ethyl-4-N,1-dimethyl-5-N-[(7R)-2-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]pyrazole-4,5-dicarboxamide (PubChem CID 165414938) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-N-ethyl-4-N,1-dimethyl-5-N-[(7R)-2-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]pyrazole-4,5-dicarboxamide.
| Compound Name | 4-N-ethyl-4-N,1-dimethyl-5-N-[(7R)-2-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]pyrazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 165414938 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4-N-ethyl-4-N,1-dimethyl-5-N-[(7R)-2-phenyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]pyrazole-4,5-dicarboxamide |
| SMILES | CCN(C)C(=O)c1cnn(C)c1C(=O)N[C@@H]1CCn2cc(-c3ccccc3)nc2C1 |
| InChI | InChI=1S/C22H26N6O2/c1-4-26(2)22(30)17-13-23-27(3)20(17)21(29)24-16-10-11-28-14-18(25-19(28)12-16)15-8-6-5-7-9-15/h5-9,13-14,16H,4,10-12H2,1-3H3,(H,24,29)/t16-/m1/s1 |
| InChIKey | VTCZCBMFPRSPMU-MRXNPFEDSA-N |
| XLogP | 2.12 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |