C22H22N6O3 — CID 165414949
4-N,4-N-diethyl-3-methyl-5-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1,2-oxazole-4,5-dicarboxamide (PubChem CID 165414949) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 4-N,4-N-diethyl-3-methyl-5-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1,2-oxazole-4,5-dicarboxamide.
| Compound Name | 4-N,4-N-diethyl-3-methyl-5-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1,2-oxazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 165414949 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 4-N,4-N-diethyl-3-methyl-5-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1,2-oxazole-4,5-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1c(C)noc1C(=O)Nc1ccn2nc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C22H22N6O3/c1-4-27(5-2)22(30)18-14(3)26-31-19(18)21(29)23-16-11-12-28-17(13-16)24-20(25-28)15-9-7-6-8-10-15/h6-13H,4-5H2,1-3H3,(H,23,29) |
| InChIKey | OGRIXWXKARBZBY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 105.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |