C18H22N10O — CID 165414964
4-[5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-1-methyl-1,2,4-triazol-3-yl]-N,1-dimethylpyrazole-5-carboxamide (PubChem CID 165414964) has the molecular formula C18H22N10O and a molecular weight of 394.44 g/mol. Its IUPAC name is 4-[5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-1-methyl-1,2,4-triazol-3-yl]-N,1-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-[5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-1-methyl-1,2,4-triazol-3-yl]-N,1-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 165414964 |
| Molecular Formula | C18H22N10O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 4-[5-[2-(5,8-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)ethyl]-1-methyl-1,2,4-triazol-3-yl]-N,1-dimethylpyrazole-5-carboxamide |
| SMILES | CNC(=O)c1c(-c2nc(CCc3nc4c(C)ncc(C)n4n3)n(C)n2)cnn1C |
| InChI | InChI=1S/C18H22N10O/c1-10-8-20-11(2)17-22-13(24-28(10)17)6-7-14-23-16(25-26(14)4)12-9-21-27(5)15(12)18(29)19-3/h8-9H,6-7H2,1-5H3,(H,19,29) |
| InChIKey | PVCMHTSBTLXLQA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |