C16H19ClN8 — CID 165415005
8-chloro-5,7-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-c]pyrimidine (PubChem CID 165415005) has the molecular formula C16H19ClN8 and a molecular weight of 358.84 g/mol. Its IUPAC name is 8-chloro-5,7-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-c]pyrimidine.
| Compound Name | 8-chloro-5,7-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-c]pyrimidine |
|---|---|
| PubChem CID | 165415005 |
| Molecular Formula | C16H19ClN8 |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 8-chloro-5,7-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-c]pyrimidine |
| SMILES | Cc1nc(C)n2nc(/C=C/c3nc(N4CCCC4)nn3C)nc2c1Cl |
| InChI | InChI=1S/C16H19ClN8/c1-10-14(17)15-19-12(21-25(15)11(2)18-10)6-7-13-20-16(22-23(13)3)24-8-4-5-9-24/h6-7H,4-5,8-9H2,1-3H3/b7-6+ |
| InChIKey | YIGODYUNBOKKRW-VOTSOKGWSA-N |
| XLogP | 2.29 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |