C17H20BrN7 — CID 165415020
6-bromo-7,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 165415020) has the molecular formula C17H20BrN7 and a molecular weight of 402.30 g/mol. Its IUPAC name is 6-bromo-7,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-bromo-7,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 165415020 |
| Molecular Formula | C17H20BrN7 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 6-bromo-7,8-dimethyl-2-[(E)-2-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethenyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1c(Br)cn2nc(/C=C/c3nc(N4CCCC4)nn3C)nc2c1C |
| InChI | InChI=1S/C17H20BrN7/c1-11-12(2)16-19-14(21-25(16)10-13(11)18)6-7-15-20-17(22-23(15)3)24-8-4-5-9-24/h6-7,10H,4-5,8-9H2,1-3H3/b7-6+ |
| InChIKey | VZUQSMHYWZXFDI-VOTSOKGWSA-N |
| XLogP | 3.01 |
| TPSA | 64.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |