C16H14Cl2N6 — CID 165415072
6-chloro-2-[2-(6-chloro-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 165415072) has the molecular formula C16H14Cl2N6 and a molecular weight of 361.24 g/mol. Its IUPAC name is 6-chloro-2-[2-(6-chloro-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-chloro-2-[2-(6-chloro-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 165415072 |
| Molecular Formula | C16H14Cl2N6 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 6-chloro-2-[2-(6-chloro-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1c(Cl)ccc2nc(CCc3nc4ccc(Cl)c(C)n4n3)nn12 |
| InChI | InChI=1S/C16H14Cl2N6/c1-9-11(17)3-7-15-19-13(21-23(9)15)5-6-14-20-16-8-4-12(18)10(2)24(16)22-14/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | ZUIKEOARBIJYLF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |