About 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine
6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine (PubChem CID 165415105) has the molecular formula C18H16ClN5O
and a molecular weight of 353.81 g/mol. Its IUPAC name is 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine |
| PubChem CID | 165415105 |
| Molecular Formula | C18H16ClN5O |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine |
| SMILES | CN(C)c1nc(OCc2cc3ccccn3n2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H16ClN5O/c1-23(2)17-15-9-12(19)6-7-16(15)20-18(21-17)25-11-13-10-14-5-3-4-8-24(14)22-13/h3-10H,11H2,1-2H3 |
| InChIKey | RBQXSZWTRKCCEI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine?
The IUPAC name of 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine (CID 165415105) is 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine.
What is the SMILES notation for 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine?
The canonical SMILES for 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine is CN(C)c1nc(OCc2cc3ccccn3n2)nc2ccc(Cl)cc12.
What is the InChIKey of 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine?
The InChIKey is RBQXSZWTRKCCEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClN5O/c1-23(2)17-15-9-12(19)6-7-16(15)20-18(21-17)25-11-13-10-14-5-3-4-8-24(14)22-13/h3-10H,11H2,1-2H3.
What are the key properties of 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine?
6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine has a molecular weight of 353.81 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N,N-dimethyl-2-(pyrazolo[1,5-a]pyridin-2-ylmethoxy)quinazolin-4-amine is sourced from PubChem (CID 165415105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).