C15H15N9 — CID 165415127
5,8-dimethyl-2-[(E)-2-[2-methyl-5-(1H-pyrazol-5-yl)-1,2,4-triazol-3-yl]ethenyl]-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 165415127) has the molecular formula C15H15N9 and a molecular weight of 321.35 g/mol. Its IUPAC name is 5,8-dimethyl-2-[(E)-2-[2-methyl-5-(1H-pyrazol-5-yl)-1,2,4-triazol-3-yl]ethenyl]-[1,2,4]triazolo[1,5-a]pyrazine.
| Compound Name | 5,8-dimethyl-2-[(E)-2-[2-methyl-5-(1H-pyrazol-5-yl)-1,2,4-triazol-3-yl]ethenyl]-[1,2,4]triazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 165415127 |
| Molecular Formula | C15H15N9 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 5,8-dimethyl-2-[(E)-2-[2-methyl-5-(1H-pyrazol-5-yl)-1,2,4-triazol-3-yl]ethenyl]-[1,2,4]triazolo[1,5-a]pyrazine |
| SMILES | Cc1ncc(C)n2nc(/C=C/c3nc(-c4ccn[nH]4)nn3C)nc12 |
| InChI | InChI=1S/C15H15N9/c1-9-8-16-10(2)15-18-12(21-24(9)15)4-5-13-19-14(22-23(13)3)11-6-7-17-20-11/h4-8H,1-3H3,(H,17,20)/b5-4+ |
| InChIKey | SCWPEDNLCCSSSS-SNAWJCMRSA-N |
| XLogP | 1.43 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |