C14H13Cl2N5S — CID 165415205
6-[2-(6,8-dichloro-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethyl]-2,3-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 165415205) has the molecular formula C14H13Cl2N5S and a molecular weight of 354.27 g/mol. Its IUPAC name is 6-[2-(6,8-dichloro-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethyl]-2,3-dihydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[2-(6,8-dichloro-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethyl]-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 165415205 |
| Molecular Formula | C14H13Cl2N5S |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 6-[2-(6,8-dichloro-5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethyl]-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1c(Cl)cc(Cl)c2nc(CCc3cn4c(n3)SCC4)nn12 |
| InChI | InChI=1S/C14H13Cl2N5S/c1-8-10(15)6-11(16)13-18-12(19-21(8)13)3-2-9-7-20-4-5-22-14(20)17-9/h6-7H,2-5H2,1H3 |
| InChIKey | GKAPPVOTDUBRNJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |