C19H17FN6O — CID 165415249
6-cyclopropyl-N-[(3-fluorophenyl)methyl]-3-(pyrimidin-5-ylamino)pyrazine-2-carboxamide (PubChem CID 165415249) has the molecular formula C19H17FN6O and a molecular weight of 364.38 g/mol. Its IUPAC name is 6-cyclopropyl-N-[(3-fluorophenyl)methyl]-3-(pyrimidin-5-ylamino)pyrazine-2-carboxamide.
| Compound Name | 6-cyclopropyl-N-[(3-fluorophenyl)methyl]-3-(pyrimidin-5-ylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 165415249 |
| Molecular Formula | C19H17FN6O |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 6-cyclopropyl-N-[(3-fluorophenyl)methyl]-3-(pyrimidin-5-ylamino)pyrazine-2-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)c1nc(C2CC2)cnc1Nc1cncnc1 |
| InChI | InChI=1S/C19H17FN6O/c20-14-3-1-2-12(6-14)7-24-19(27)17-18(25-15-8-21-11-22-9-15)23-10-16(26-17)13-4-5-13/h1-3,6,8-11,13H,4-5,7H2,(H,23,25)(H,24,27) |
| InChIKey | KGMIVZIIGNYHMS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |