C15H11ClF3N7O — CID 165415259
6-chloro-3-(pyrimidin-5-ylamino)-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridine-2-carboxamide (PubChem CID 165415259) has the molecular formula C15H11ClF3N7O and a molecular weight of 397.75 g/mol. Its IUPAC name is 6-chloro-3-(pyrimidin-5-ylamino)-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-3-(pyrimidin-5-ylamino)-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 165415259 |
| Molecular Formula | C15H11ClF3N7O |
| Molecular Weight | 397.75 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 6-chloro-3-(pyrimidin-5-ylamino)-N-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccn(CC(F)(F)F)n1)c1nc(Cl)ccc1Nc1cncnc1 |
| InChI | InChI=1S/C15H11ClF3N7O/c16-11-2-1-10(22-9-5-20-8-21-6-9)13(23-11)14(27)24-12-3-4-26(25-12)7-15(17,18)19/h1-6,8,22H,7H2,(H,24,25,27) |
| InChIKey | OCOIAMYJJZUWKQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.75 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|