C14H20N8 — CID 165415449
5-[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)ethyl]-N,N,1-trimethyl-1,2,4-triazol-3-amine (PubChem CID 165415449) has the molecular formula C14H20N8 and a molecular weight of 300.37 g/mol. Its IUPAC name is 5-[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)ethyl]-N,N,1-trimethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)ethyl]-N,N,1-trimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 165415449 |
| Molecular Formula | C14H20N8 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 5-[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)ethyl]-N,N,1-trimethyl-1,2,4-triazol-3-amine |
| SMILES | Cc1cc(C)n2nc(CCc3nc(N(C)C)nn3C)nc2n1 |
| InChI | InChI=1S/C14H20N8/c1-9-8-10(2)22-13(15-9)16-11(18-22)6-7-12-17-14(20(3)4)19-21(12)5/h8H,6-7H2,1-5H3 |
| InChIKey | MRYNQZXSDIDDCD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |