C14H18N8 — CID 165415452
5-[(E)-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)ethenyl]-N,N,1-trimethyl-1,2,4-triazol-3-amine (PubChem CID 165415452) has the molecular formula C14H18N8 and a molecular weight of 298.35 g/mol. Its IUPAC name is 5-[(E)-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)ethenyl]-N,N,1-trimethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-[(E)-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)ethenyl]-N,N,1-trimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 165415452 |
| Molecular Formula | C14H18N8 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 5-[(E)-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)ethenyl]-N,N,1-trimethyl-1,2,4-triazol-3-amine |
| SMILES | Cc1cc(C)n2nc(/C=C/c3nc(N(C)C)nn3C)nc2n1 |
| InChI | InChI=1S/C14H18N8/c1-9-8-10(2)22-13(15-9)16-11(18-22)6-7-12-17-14(20(3)4)19-21(12)5/h6-8H,1-5H3/b7-6+ |
| InChIKey | CZHZTOWQVKSDAA-VOTSOKGWSA-N |
| XLogP | 1.11 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |