C43H86O3 — CID 165415511
[(2R,7R,11R,15S,26S,30R,34R)-7,11,15,19,22,26,30,34-octamethyl-1,4-dioxacyclohexatriacont-2-yl]methanol (PubChem CID 165415511) has the molecular formula C43H86O3 and a molecular weight of 651.16 g/mol. Its IUPAC name is [(2R,7R,11R,15S,26S,30R,34R)-7,11,15,19,22,26,30,34-octamethyl-1,4-dioxacyclohexatriacont-2-yl]methanol.
| Compound Name | [(2R,7R,11R,15S,26S,30R,34R)-7,11,15,19,22,26,30,34-octamethyl-1,4-dioxacyclohexatriacont-2-yl]methanol |
|---|---|
| PubChem CID | 165415511 |
| Molecular Formula | C43H86O3 |
| Molecular Weight | 651.16 g/mol |
| Exact Mass | 650.66 |
| IUPAC Name | [(2R,7R,11R,15S,26S,30R,34R)-7,11,15,19,22,26,30,34-octamethyl-1,4-dioxacyclohexatriacont-2-yl]methanol |
| SMILES | CC1CCC[C@@H](C)CCC[C@@H](C)CCC[C@@H](C)CCOC[C@@H](CO)OCC[C@H](C)CCC[C@H](C)CCC[C@H](C)CCCC(C)CC1 |
| InChI | InChI=1S/C43H86O3/c1-35-15-9-17-37(3)21-13-25-41(7)29-31-45-34-43(33-44)46-32-30-42(8)26-14-22-38(4)18-10-16-36(2)20-12-24-40(6)28-27-39(5)23-11-19-35/h35-44H,9-34H2,1-8H3/t35-,36-,37+,38+,39?,40?,41+,42+,43+/m0/s1 |
| InChIKey | SCROVKPCXMRTCT-NEEOITLYSA-N |
| XLogP | 13.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.16 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |