C20H30F4O3Si — CID 165415777
(2R,3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-fluoro-3-phenylmethoxy-4-(trifluoromethyl)hex-5-en-2-ol (PubChem CID 165415777) has the molecular formula C20H30F4O3Si and a molecular weight of 422.54 g/mol. Its IUPAC name is (2R,3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-fluoro-3-phenylmethoxy-4-(trifluoromethyl)hex-5-en-2-ol.
| Compound Name | (2R,3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-fluoro-3-phenylmethoxy-4-(trifluoromethyl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 165415777 |
| Molecular Formula | C20H30F4O3Si |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (2R,3R,4R)-1-[tert-butyl(dimethyl)silyl]oxy-4-fluoro-3-phenylmethoxy-4-(trifluoromethyl)hex-5-en-2-ol |
| SMILES | C=C[C@@](F)([C@H](OCc1ccccc1)[C@H](O)CO[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C20H30F4O3Si/c1-7-19(21,20(22,23)24)17(26-13-15-11-9-8-10-12-15)16(25)14-27-28(5,6)18(2,3)4/h7-12,16-17,25H,1,13-14H2,2-6H3/t16-,17-,19-/m1/s1 |
| InChIKey | SFUUBYKVGPWNRH-ZHALLVOQSA-N |
| XLogP | 5.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|