C12H12F4OS — CID 165415792
(1S,2R)-2-fluoro-1-(4-methylsulfanylphenyl)-2-(trifluoromethyl)but-3-en-1-ol (PubChem CID 165415792) has the molecular formula C12H12F4OS and a molecular weight of 280.29 g/mol. Its IUPAC name is (1S,2R)-2-fluoro-1-(4-methylsulfanylphenyl)-2-(trifluoromethyl)but-3-en-1-ol.
| Compound Name | (1S,2R)-2-fluoro-1-(4-methylsulfanylphenyl)-2-(trifluoromethyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 165415792 |
| Molecular Formula | C12H12F4OS |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (1S,2R)-2-fluoro-1-(4-methylsulfanylphenyl)-2-(trifluoromethyl)but-3-en-1-ol |
| SMILES | C=C[C@@](F)([C@@H](O)c1ccc(SC)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H12F4OS/c1-3-11(13,12(14,15)16)10(17)8-4-6-9(18-2)7-5-8/h3-7,10,17H,1H2,2H3/t10-,11+/m0/s1 |
| InChIKey | XSYFJLSRSBXWBQ-WDEREUQCSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|