C10H16BF3O2 — CID 165415799
4,4,5,5-tetramethyl-2-[(E)-4,4,4-trifluorobut-2-enyl]-1,3,2-dioxaborolane (PubChem CID 165415799) has the molecular formula C10H16BF3O2 and a molecular weight of 236.04 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E)-4,4,4-trifluorobut-2-enyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E)-4,4,4-trifluorobut-2-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 165415799 |
| Molecular Formula | C10H16BF3O2 |
| Molecular Weight | 236.04 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-4,4,4-trifluorobut-2-enyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C/C=C/C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C10H16BF3O2/c1-8(2)9(3,4)16-11(15-8)7-5-6-10(12,13)14/h5-6H,7H2,1-4H3/b6-5+ |
| InChIKey | AXMMXEZEFZTFBX-AATRIKPKSA-N |
| XLogP | 3.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.04 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|