C14H22F4O — CID 165415816
(3R,4S,6S)-3-fluoro-6,10-dimethyl-3-(trifluoromethyl)undeca-1,9-dien-4-ol (PubChem CID 165415816) has the molecular formula C14H22F4O and a molecular weight of 282.32 g/mol. Its IUPAC name is (3R,4S,6S)-3-fluoro-6,10-dimethyl-3-(trifluoromethyl)undeca-1,9-dien-4-ol.
| Compound Name | (3R,4S,6S)-3-fluoro-6,10-dimethyl-3-(trifluoromethyl)undeca-1,9-dien-4-ol |
|---|---|
| PubChem CID | 165415816 |
| Molecular Formula | C14H22F4O |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (3R,4S,6S)-3-fluoro-6,10-dimethyl-3-(trifluoromethyl)undeca-1,9-dien-4-ol |
| SMILES | C=C[C@@](F)([C@@H](O)C[C@@H](C)CCC=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H22F4O/c1-5-13(15,14(16,17)18)12(19)9-11(4)8-6-7-10(2)3/h5,7,11-12,19H,1,6,8-9H2,2-4H3/t11-,12-,13+/m0/s1 |
| InChIKey | PPWKGACJOWKNIM-RWMBFGLXSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|