C16H23N8+ — CID 165416160
5,8-dimethyl-2-[2-(1-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]-6H-[1,2,4]triazolo[1,5-a]pyrazin-4-ium (PubChem CID 165416160) has the molecular formula C16H23N8+ and a molecular weight of 327.42 g/mol. Its IUPAC name is 5,8-dimethyl-2-[2-(1-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]-6H-[1,2,4]triazolo[1,5-a]pyrazin-4-ium.
| Compound Name | 5,8-dimethyl-2-[2-(1-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]-6H-[1,2,4]triazolo[1,5-a]pyrazin-4-ium |
|---|---|
| PubChem CID | 165416160 |
| Molecular Formula | C16H23N8+ |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 5,8-dimethyl-2-[2-(1-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]-6H-[1,2,4]triazolo[1,5-a]pyrazin-4-ium |
| SMILES | CC1=NCC(C)=[N+]2N=C(CCc3nc(N4CCCC4)n(C)n3)N=C12 |
| InChI | InChI=1S/C16H23N8/c1-11-10-17-12(2)15-18-13(21-24(11)15)6-7-14-19-16(22(3)20-14)23-8-4-5-9-23/h4-10H2,1-3H3/q+1 |
| InChIKey | LGSBAVHZLJVZJT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 74.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|