C17H15ClN5O+ — CID 165416182
3-(2-chlorophenyl)-12-methoxy-5-methyl-4,8,13-triaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,5,7,10,12-hexaen-7-amine (PubChem CID 165416182) has the molecular formula C17H15ClN5O+ and a molecular weight of 340.79 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-12-methoxy-5-methyl-4,8,13-triaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,5,7,10,12-hexaen-7-amine.
| Compound Name | 3-(2-chlorophenyl)-12-methoxy-5-methyl-4,8,13-triaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,5,7,10,12-hexaen-7-amine |
|---|---|
| PubChem CID | 165416182 |
| Molecular Formula | C17H15ClN5O+ |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-(2-chlorophenyl)-12-methoxy-5-methyl-4,8,13-triaza-2-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,5,7,10,12-hexaen-7-amine |
| SMILES | COc1ccc2nc(N)c3c(C)[nH]c(-c4ccccc4Cl)[n+]3c2n1 |
| InChI | InChI=1S/C17H14ClN5O/c1-9-14-15(19)21-12-7-8-13(24-2)22-17(12)23(14)16(20-9)10-5-3-4-6-11(10)18/h3-8H,1-2H3,(H2,19,21)/p+1 |
| InChIKey | VZYHJJOJTOWJSO-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|