C18H28N6O — CID 165416236
3-cyclohexyl-N-[(2S)-1-(7H-purin-6-ylamino)butan-2-yl]propanamide (PubChem CID 165416236) has the molecular formula C18H28N6O and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-cyclohexyl-N-[(2S)-1-(7H-purin-6-ylamino)butan-2-yl]propanamide.
| Compound Name | 3-cyclohexyl-N-[(2S)-1-(7H-purin-6-ylamino)butan-2-yl]propanamide |
|---|---|
| PubChem CID | 165416236 |
| Molecular Formula | C18H28N6O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 3-cyclohexyl-N-[(2S)-1-(7H-purin-6-ylamino)butan-2-yl]propanamide |
| SMILES | CC[C@@H](CNc1ncnc2nc[nH]c12)NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C18H28N6O/c1-2-14(24-15(25)9-8-13-6-4-3-5-7-13)10-19-17-16-18(21-11-20-16)23-12-22-17/h11-14H,2-10H2,1H3,(H,24,25)(H2,19,20,21,22,23)/t14-/m0/s1 |
| InChIKey | YUSKQHZYIKIRME-AWEZNQCLSA-N |
| XLogP | 3.02 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |