C27H25N3O2S2 — CID 16541662
1-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one (PubChem CID 16541662) has the molecular formula C27H25N3O2S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 1-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 16541662 |
| Molecular Formula | C27H25N3O2S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 1-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]benzo[f]chromen-3-one |
| SMILES | O=c1cc(CSc2nnc(Cc3cccs3)n2C2CCCCC2)c2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C27H25N3O2S2/c31-25-15-19(26-22-11-5-4-7-18(22)12-13-23(26)32-25)17-34-27-29-28-24(16-21-10-6-14-33-21)30(27)20-8-2-1-3-9-20/h4-7,10-15,20H,1-3,8-9,16-17H2 |
| InChIKey | QCJWOJGEYMYHBR-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|