C37H68B4O8 — CID 165416681
4,4,5,5-tetramethyl-2-[(4R,6S,8S,10R)-6,8,10-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)trideca-1,12-dien-4-yl]-1,3,2-dioxaborolane (PubChem CID 165416681) has the molecular formula C37H68B4O8 and a molecular weight of 684.19 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(4R,6S,8S,10R)-6,8,10-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)trideca-1,12-dien-4-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(4R,6S,8S,10R)-6,8,10-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)trideca-1,12-dien-4-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 165416681 |
| Molecular Formula | C37H68B4O8 |
| Molecular Weight | 684.19 g/mol |
| Exact Mass | 684.53 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(4R,6S,8S,10R)-6,8,10-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)trideca-1,12-dien-4-yl]-1,3,2-dioxaborolane |
| SMILES | C=CC[C@@H](CC(C[C@@H](C[C@H](CC=C)B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C37H68B4O8/c1-19-21-26(38-42-30(3,4)31(5,6)43-38)23-28(40-46-34(11,12)35(13,14)47-40)25-29(41-48-36(15,16)37(17,18)49-41)24-27(22-20-2)39-44-32(7,8)33(9,10)45-39/h19-20,26-29H,1-2,21-25H2,3-18H3/t26-,27-,28+,29?/m0/s1 |
| InChIKey | MQDAANIEWDOOGD-YAZNYETNSA-N |
| XLogP | 9.16 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.19 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|