C37H72B4O8 — CID 165416692
4,4,5,5-tetramethyl-2-[(1R,3S,5S,7R)-8-methyl-1-propan-2-yl-3,5,7-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl]-1,3,2-dioxaborolane (PubChem CID 165416692) has the molecular formula C37H72B4O8 and a molecular weight of 688.22 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(1R,3S,5S,7R)-8-methyl-1-propan-2-yl-3,5,7-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(1R,3S,5S,7R)-8-methyl-1-propan-2-yl-3,5,7-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 165416692 |
| Molecular Formula | C37H72B4O8 |
| Molecular Weight | 688.22 g/mol |
| Exact Mass | 688.56 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(1R,3S,5S,7R)-8-methyl-1-propan-2-yl-3,5,7-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nonyl]-1,3,2-dioxaborolane |
| SMILES | CC(C)[C@@H](CC(C[C@@H](C[C@@H](B1OC(C)(C)C(C)(C)O1)C(C)C)B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C37H72B4O8/c1-24(2)28(40-46-34(13,14)35(15,16)47-40)22-26(38-42-30(5,6)31(7,8)43-38)21-27(39-44-32(9,10)33(11,12)45-39)23-29(25(3)4)41-48-36(17,18)37(19,20)49-41/h24-29H,21-23H2,1-20H3/t26-,27?,28+,29+/m0/s1 |
| InChIKey | PPMHNRRDGHLIRR-GLVAHPDSSA-N |
| XLogP | 9.32 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.22 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|