C34H70O10Si — CID 165416714
(3S,4S,7S,9S,11S,13R,15S,17R,19R,21R,23R)-23-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhexacos-25-ene-3,7,9,11,13,15,17,19,21-nonol (PubChem CID 165416714) has the molecular formula C34H70O10Si and a molecular weight of 667.01 g/mol. Its IUPAC name is (3S,4S,7S,9S,11S,13R,15S,17R,19R,21R,23R)-23-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhexacos-25-ene-3,7,9,11,13,15,17,19,21-nonol.
| Compound Name | (3S,4S,7S,9S,11S,13R,15S,17R,19R,21R,23R)-23-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhexacos-25-ene-3,7,9,11,13,15,17,19,21-nonol |
|---|---|
| PubChem CID | 165416714 |
| Molecular Formula | C34H70O10Si |
| Molecular Weight | 667.01 g/mol |
| Exact Mass | 666.47 |
| IUPAC Name | (3S,4S,7S,9S,11S,13R,15S,17R,19R,21R,23R)-23-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhexacos-25-ene-3,7,9,11,13,15,17,19,21-nonol |
| SMILES | C=CC[C@H](C[C@H](O)C[C@H](O)C[C@H](O)C[C@@H](O)C[C@H](O)C[C@@H](O)C[C@@H](O)C[C@@H](O)CC[C@H](C)[C@@H](O)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H70O10Si/c1-10-11-32(44-45(8,9)34(5,6)7)21-31(42)20-30(41)19-29(40)18-28(39)17-27(38)16-26(37)15-25(36)14-24(35)13-12-23(4)33(43)22(2)3/h10,22-33,35-43H,1,11-21H2,2-9H3/t23-,24-,25-,26-,27+,28-,29+,30+,31+,32+,33-/m0/s1 |
| InChIKey | LKFOPVRPHLMRKH-SPGDVFFPSA-N |
| XLogP | 3.39 |
| TPSA | 191.30 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.01 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|