About 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide
5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide (PubChem CID 165416878) has the molecular formula C10H11BrF2N2O2
and a molecular weight of 309.11 g/mol. Its IUPAC name is 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide |
| PubChem CID | 165416878 |
| Molecular Formula | C10H11BrF2N2O2 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide |
| SMILES | CCn1cc(Br)cc(C(=O)NCC(F)F)c1=O |
| InChI | InChI=1S/C10H11BrF2N2O2/c1-2-15-5-6(11)3-7(10(15)17)9(16)14-4-8(12)13/h3,5,8H,2,4H2,1H3,(H,14,16) |
| InChIKey | NYOOSLMBNNWTCL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide?
The IUPAC name of 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide (CID 165416878) is 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide.
What is the SMILES notation for 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide?
The canonical SMILES for 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide is CCn1cc(Br)cc(C(=O)NCC(F)F)c1=O.
What is the InChIKey of 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide?
The InChIKey is NYOOSLMBNNWTCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrF2N2O2/c1-2-15-5-6(11)3-7(10(15)17)9(16)14-4-8(12)13/h3,5,8H,2,4H2,1H3,(H,14,16).
What are the key properties of 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide?
5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide has a molecular weight of 309.11 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2,2-difluoroethyl)-1-ethyl-2-oxopyridine-3-carboxamide is sourced from PubChem (CID 165416878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).