C15H22N4O2 — CID 165418548
N-[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N,3,5-trimethyl-1H-pyrazole-4-carboxamide (PubChem CID 165418548) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N,3,5-trimethyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N,3,5-trimethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 165418548 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-[(4aS,6S,7aS)-3-oxo-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-6-yl]-N,3,5-trimethyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1C(=O)N(C)[C@H]1C[C@H]2CC(=O)NC[C@H]2C1 |
| InChI | InChI=1S/C15H22N4O2/c1-8-14(9(2)18-17-8)15(21)19(3)12-4-10-6-13(20)16-7-11(10)5-12/h10-12H,4-7H2,1-3H3,(H,16,20)(H,17,18)/t10-,11+,12-/m0/s1 |
| InChIKey | ZGZWOIARKLDHLK-TUAOUCFPSA-N |
| XLogP | 1.01 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |