About [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone
[4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone (PubChem CID 165419116) has the molecular formula C23H28N4OS
and a molecular weight of 408.57 g/mol. Its IUPAC name is [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone.
Molecular Properties
| Compound Name | [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone |
| PubChem CID | 165419116 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone |
| SMILES | CCCCNc1nc(C2(c3ccccc3)CCN(C(=O)c3cc[nH]c3)CC2)cs1 |
| InChI | InChI=1S/C23H28N4OS/c1-2-3-12-25-22-26-20(17-29-22)23(19-7-5-4-6-8-19)10-14-27(15-11-23)21(28)18-9-13-24-16-18/h4-9,13,16-17,24H,2-3,10-12,14-15H2,1H3,(H,25,26) |
| InChIKey | SKCRRGDSCKAZJG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone?
The IUPAC name of [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone (CID 165419116) is [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone.
What is the SMILES notation for [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone?
The canonical SMILES for [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone is CCCCNc1nc(C2(c3ccccc3)CCN(C(=O)c3cc[nH]c3)CC2)cs1.
What is the InChIKey of [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone?
The InChIKey is SKCRRGDSCKAZJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4OS/c1-2-3-12-25-22-26-20(17-29-22)23(19-7-5-4-6-8-19)10-14-27(15-11-23)21(28)18-9-13-24-16-18/h4-9,13,16-17,24H,2-3,10-12,14-15H2,1H3,(H,25,26).
What are the key properties of [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone?
[4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone has a molecular weight of 408.57 g/mol, XLogP of 4.91, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(butylamino)-1,3-thiazol-4-yl]-4-phenylpiperidin-1-yl]-(1H-pyrrol-3-yl)methanone is sourced from PubChem (CID 165419116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).