C15H14Cl2N2O3 — CID 165419975
(3S,3aR,6R,6aR)-3-[2-(3,4-dichlorophenyl)imidazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 165419975) has the molecular formula C15H14Cl2N2O3 and a molecular weight of 341.19 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-3-[2-(3,4-dichlorophenyl)imidazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | (3S,3aR,6R,6aR)-3-[2-(3,4-dichlorophenyl)imidazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 165419975 |
| Molecular Formula | C15H14Cl2N2O3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | (3S,3aR,6R,6aR)-3-[2-(3,4-dichlorophenyl)imidazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1ccnc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N2O3/c16-9-2-1-8(5-10(9)17)15-18-3-4-19(15)11-6-21-14-12(20)7-22-13(11)14/h1-5,11-14,20H,6-7H2/t11-,12+,13+,14+/m0/s1 |
| InChIKey | UXAPXHLOTOFJPD-REWJHTLYSA-N |
| XLogP | 2.56 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |