C16H16N2O2S — CID 165421202
4-[5-(morpholin-4-ylmethyl)thiophen-2-yl]furo[3,2-c]pyridine (PubChem CID 165421202) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 4-[5-(morpholin-4-ylmethyl)thiophen-2-yl]furo[3,2-c]pyridine.
| Compound Name | 4-[5-(morpholin-4-ylmethyl)thiophen-2-yl]furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 165421202 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-[5-(morpholin-4-ylmethyl)thiophen-2-yl]furo[3,2-c]pyridine |
| SMILES | c1cc2occc2c(-c2ccc(CN3CCOCC3)s2)n1 |
| InChI | InChI=1S/C16H16N2O2S/c1-2-15(16-13-4-8-20-14(13)3-5-17-16)21-12(1)11-18-6-9-19-10-7-18/h1-5,8H,6-7,9-11H2 |
| InChIKey | YHMJSZBDHLLLBY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |