C18H24N2O4 — CID 165422573
[4-[[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]piperidin-1-yl]-phenylmethanone (PubChem CID 165422573) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is [4-[[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]piperidin-1-yl]-phenylmethanone.
| Compound Name | [4-[[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 165422573 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | [4-[[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]piperidin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCC(N[C@H]2CO[C@H]3[C@@H]2OC[C@H]3O)CC1 |
| InChI | InChI=1S/C18H24N2O4/c21-15-11-24-16-14(10-23-17(15)16)19-13-6-8-20(9-7-13)18(22)12-4-2-1-3-5-12/h1-5,13-17,19,21H,6-11H2/t14-,15+,16+,17+/m0/s1 |
| InChIKey | HGNGNPNDMFYQTP-YLFCFFPRSA-N |
| XLogP | 0.41 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |