C22H26N2O4 — CID 165422735
(3S)-3-benzyl-4-[2-(2-ethoxyphenoxy)ethyl]-1-methylpiperazine-2,5-dione (PubChem CID 165422735) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is (3S)-3-benzyl-4-[2-(2-ethoxyphenoxy)ethyl]-1-methylpiperazine-2,5-dione.
| Compound Name | (3S)-3-benzyl-4-[2-(2-ethoxyphenoxy)ethyl]-1-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 165422735 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (3S)-3-benzyl-4-[2-(2-ethoxyphenoxy)ethyl]-1-methylpiperazine-2,5-dione |
| SMILES | CCOc1ccccc1OCCN1C(=O)CN(C)C(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H26N2O4/c1-3-27-19-11-7-8-12-20(19)28-14-13-24-18(15-17-9-5-4-6-10-17)22(26)23(2)16-21(24)25/h4-12,18H,3,13-16H2,1-2H3/t18-/m0/s1 |
| InChIKey | DSNJCZQWZGABQM-SFHVURJKSA-N |
| XLogP | 2.38 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |