C21H23N5O2 — CID 165422883
[2-(4-imidazo[1,2-a]pyridin-2-yl-4-phenylpiperidin-1-yl)-2-oxoethyl]urea (PubChem CID 165422883) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is [2-(4-imidazo[1,2-a]pyridin-2-yl-4-phenylpiperidin-1-yl)-2-oxoethyl]urea.
| Compound Name | [2-(4-imidazo[1,2-a]pyridin-2-yl-4-phenylpiperidin-1-yl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 165422883 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [2-(4-imidazo[1,2-a]pyridin-2-yl-4-phenylpiperidin-1-yl)-2-oxoethyl]urea |
| SMILES | NC(=O)NCC(=O)N1CCC(c2ccccc2)(c2cn3ccccc3n2)CC1 |
| InChI | InChI=1S/C21H23N5O2/c22-20(28)23-14-19(27)25-12-9-21(10-13-25,16-6-2-1-3-7-16)17-15-26-11-5-4-8-18(26)24-17/h1-8,11,15H,9-10,12-14H2,(H3,22,23,28) |
| InChIKey | XLMDYVZCYLCIQR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |