C23H28N4OS — CID 165423414
(3aR,6aS)-3a-[(4-imidazo[2,1-b][1,3]thiazol-6-yl-4-phenylpiperidin-1-yl)methyl]-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 165423414) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is (3aR,6aS)-3a-[(4-imidazo[2,1-b][1,3]thiazol-6-yl-4-phenylpiperidin-1-yl)methyl]-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-3a-[(4-imidazo[2,1-b][1,3]thiazol-6-yl-4-phenylpiperidin-1-yl)methyl]-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 165423414 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (3aR,6aS)-3a-[(4-imidazo[2,1-b][1,3]thiazol-6-yl-4-phenylpiperidin-1-yl)methyl]-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrole |
| SMILES | c1ccc(C2(c3cn4ccsc4n3)CCN(C[C@]34CNC[C@H]3COC4)CC2)cc1 |
| InChI | InChI=1S/C23H28N4OS/c1-2-4-18(5-3-1)23(20-13-27-10-11-29-21(27)25-20)6-8-26(9-7-23)16-22-15-24-12-19(22)14-28-17-22/h1-5,10-11,13,19,24H,6-9,12,14-17H2/t19-,22-/m0/s1 |
| InChIKey | NABXGHJHJLSPJS-UGKGYDQZSA-N |
| XLogP | 3.01 |
| TPSA | 41.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |